![[3-(2-methylpropyl)imidazol-4-yl]methanol (CAS: 226930-88-7) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0724041.png "[3-(2-methylpropyl)imidazol-4-yl]methanol chemical structure")
[3-(2-methylpropyl)imidazol-4-yl]methanol
Catalog No: FT-0724041
CAS No: 226930-88-7
- Chemical Name: [3-(2-methylpropyl)imidazol-4-yl]methanol
- Molecular Formula: C8H14N2O
- Molecular Weight: 154.21
- InChI Key: QHLQRYOQMUYPSS-UHFFFAOYSA-N
- InChI: InChI=1S/C8H14N2O/c1-7(2)4-10-6-9-3-8(10)5-11/h3,6-7,11H,4-5H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 226930-88-7 |
|---|---|
| MF: | C8H14N2O |
| Density: | 1.073g/cm3 |
| Flash_Point: | 151.512ºC |
| Melting_Point: | N/A |
| Product_Name: | (1-Isobutyl-1H-imidazol-5-yl)methanol |
| Symbol: | GHS07 |
| Bolling_Point: | 326.913ºC at 760 mmHg |
| FW: | 154.21000 |
| Bolling_Point: | 326.913ºC at 760 mmHg |
|---|---|
| Density: | 1.073g/cm3 |
| MF: | C8H14N2O |
| LogP: | 1.03140 |
| Exact_Mass: | 154.11100 |
| Vapor_Pressure: | 0mmHg at 25°C |
| Flash_Point: | 151.512ºC |
| FW: | 154.21000 |
| Refractive_Index: | 1.529 |
| PSA: | 38.05000 |
| Safety_Statements: | H319 |
|---|---|
| Symbol: | GHS07 |
| Warning_Statement: | P305 + P351 + P338 |
| HS_Code: | 2933290090 |
| RIDADR: | NONH for all modes of transport |
